| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | rac-(2R)-1,2-dichloropropane |
| IUPAC name: | (2RS)-1,2-dichloropropane |
| CAS name: | 1,2-dichloropropane |
| CAS Reg. No.: | 78-87-5 |
| Formula: | C3H6Cl2 |
| Activity: | insecticides (alkyl halide; fumigant) nematicides (alkyl halide; fumigant) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | wǔn too dī-klor-ō-prō-pān Guide to British pronunciation |
| InChIKey: | KNKRKFALVUDBJE-UHFFFAOYSA-N |
| InChI: | InChI=1S/C3H6Cl2/c1-3(5)2-4/h3H,2H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names