Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | rac-(2R)-1,2-dichloropropane |
IUPAC name: | (2RS)-1,2-dichloropropane |
CAS name: | 1,2-dichloropropane |
CAS Reg. No.: | 78-87-5 |
Formula: | C3H6Cl2 |
Activity: | insecticides (alkyl halide; fumigant) nematicides (alkyl halide; fumigant) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | wǔn too dī-klor-ō-prō-pān Guide to British pronunciation |
InChIKey: | KNKRKFALVUDBJE-UHFFFAOYSA-N |
InChI: | InChI=1S/C3H6Cl2/c1-3(5)2-4/h3H,2H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names