| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | naphthalen-1-ol |
| IUPAC name: | 1-naphthol |
| CAS name: | 1-naphthalenol |
| CAS Reg. No.: | 90-15-3 |
| Formula: | C10H8O |
| Activity: | plant growth regulators (auxin) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | wǔn nǎf-thǒl Guide to British pronunciation |
| InChIKey: | KJCVRFUGPWSIIH-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H8O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H |
A data sheet from the Compendium of Pesticide Common Names