Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 4-(2,4,5-trichlorophenoxy)butanoic acid |
IUPAC name: | 4-(2,4,5-trichlorophenoxy)butanoic acid 1979 Rules: 4-(2,4,5-trichlorophenoxy)butyric acid |
CAS name: | 4-(2,4,5-trichlorophenoxy)butanoic acid |
CAS Reg. No.: | 93-80-1 |
Formula: | C10H9Cl3O3 |
Activity: | herbicides (phenoxybutyric) |
Notes: | |
Structure: | |
Pronunciation: | too for fīv tē bē Guide to British pronunciation |
InChIKey: | RTWCZQFXFMXXKP-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H9Cl3O3/c11-6-4-8(13)9(5-7(6)12)16-3-1-2-10(14)15/h4-5H,1-3H2,(H,14,15) |
A data sheet from the Compendium of Pesticide Common Names