| Approval: | WSSA |
|---|---|
| IUPAC PIN: | tris[2-(2,4-dichlorophenoxy)ethyl] phosphite |
| IUPAC name: | tris[2-(2,4-dichlorophenoxy)ethyl] phosphite |
| CAS name: | tris[2-(2,4-dichlorophenoxy)ethyl] phosphite |
| CAS Reg. No.: | 94-84-8 |
| Formula: | C24H21Cl6O6P |
| Activity: | herbicides (phenoxyacetic) |
| Notes: | There is no ISO common name for this substance; the name “2,4-DEP” is approved by the Weed Science Society of America. |
| Structure: | |
| Pronunciation: | too for dē ē pē Guide to British pronunciation |
| InChIKey: | PIHCREFCPDWIPY-UHFFFAOYSA-N |
| InChI: | InChI=1S/C24H21Cl6O6P/c25-16-1-4-22(19(28)13-16)31-7-10-34-37(35-11-8-32-23-5-2-17(26)14-20(23)29)36-12-9-33-24-6-3-18(27)15-21(24)30/h1-6,13-15H,7-12H2 |
A data sheet from the Compendium of Pesticide Common Names