| Status: | none |
|---|---|
| IUPAC PIN: | 2,5-dichlorobenzoic acid |
| IUPAC name: | 2,5-dichlorobenzoic acid |
| CAS name: | 2,5-dichlorobenzoic acid |
| CAS Reg. No.: | 50-79-3 |
| Formula: | C7H4Cl2O2 |
| Activity: | fungicides (unclassified) plant growth regulators (unclassified) |
| Notes: | There is no ISO common name for this substance. When this substance is used as an ester or a salt, its identity should be stated, for example methyl 2,5-dichlorobenzoate [2905-69-3] |
| Structure: |  |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | QVTQYSFCFOGITD-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H4Cl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) |