| Status: | WSSA |
|---|---|
| IUPAC PIN: | 4-(3,4-dichlorophenoxy)butanoic acid |
| IUPAC name: | 4-(3,4-dichlorophenoxy)butanoic acid 1979 Rules: 4-(3,4-dichlorophenoxy)butyric acid |
| CAS name: | 4-(3,4-dichlorophenoxy)butanoic acid |
| CAS Reg. No.: | 3307-37-7 |
| Formula: | C10H10Cl2O3 |
| Activity: | herbicides (phenoxybutyric) |
| Notes: | There is no ISO common name for this substance; the name “3,4-DB” is approved by the Weed Science Society of America. |
| Structure: |  |
| Pronunciation: | thrē for dē bē Guide to British pronunciation |
| InChIKey: | AKDSUKZFDDKNNM-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H10Cl2O3/c11-8-4-3-7(6-9(8)12)15-5-1-2-10(13)14/h3-4,6H,1-2,5H2,(H,13,14) |