Approval: | WSSA |
---|---|
IUPAC PIN: | rac-(2R)-2-(3,4-dichlorophenoxy)propanoic acid |
IUPAC name: | (2RS)-2-(3,4-dichlorophenoxy)propanoic acid 1979 Rules: (RS)-2-(3,4-dichlorophenoxy)propionic acid |
CAS name: | 2-(3,4-dichlorophenoxy)propanoic acid |
CAS Reg. No.: | 3307-41-3 |
Formula: | C9H8Cl2O3 |
Activity: | herbicides (phenoxypropionic) |
Notes: | There is no ISO common name for this substance; the name “3,4-DP” is approved by the Weed Science Society of America. |
Structure: | |
Pronunciation: | thrē for dē pē Guide to British pronunciation |
InChIKey: | BIPAGODSEBNAJR-UHFFFAOYSA-N |
InChI: | InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-6-2-3-7(10)8(11)4-6/h2-5H,1H3,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names