| Approval: | none |
|---|---|
| IUPAC PIN: | 3-chloro-4-methylaniline |
| IUPAC name: | 3-chloro-4-methylaniline 3-chloro-p-methylaniline |
| CAS name: | 3-chloro-4-methylbenzenamine |
| CAS Reg. No.: | 95-74-9 |
| Formula: | C7H8ClN |
| Activity: | avicides |
| Notes: | There is no ISO common name for this substance. The name "starlicide" has been used in the literature but this is also used as a trade name for this compound. Derivatives include 3-chloro-4-methylaniline hydrochloride [7745-89-3] |
| Structure: |  |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | RQKFYFNZSHWXAW-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H8ClN/c1-5-2-3-6(9)4-7(5)8/h2-4H,9H2,1H3 |