Status: | WSSA |
---|---|
IUPAC PIN: | 4-(4-chlorophenoxy)butanoic acid |
IUPAC name: | 4-(4-chlorophenoxy)butanoic acid 1979 Rules: 4-(4-chlorophenoxy)butyric acid |
CAS name: | 4-(4-chlorophenoxy)butanoic acid |
CAS Reg. No.: | 3547-07-7 |
Formula: | C10H11ClO3 |
Activity: | herbicides (phenoxybutyric) |
Notes: | There is no ISO common name for this substance; the name “4-CPB” is approved by the Weed Science Society of America. |
Structure: | |
Pronunciation: | for sē pē bē Guide to British pronunciation |
InChIKey: | SIYAHZSHQIPQLY-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H11ClO3/c11-8-3-5-9(6-4-8)14-7-1-2-10(12)13/h3-6H,1-2,7H2,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names