| Approval: | WSSA |
|---|---|
| IUPAC PIN: | 4-(4-chlorophenoxy)butanoic acid |
| IUPAC name: | 4-(4-chlorophenoxy)butanoic acid 1979 Rules: 4-(4-chlorophenoxy)butyric acid |
| CAS name: | 4-(4-chlorophenoxy)butanoic acid |
| CAS Reg. No.: | 3547-07-7 |
| Formula: | C10H11ClO3 |
| Activity: | herbicides (phenoxybutyric) |
| Notes: | There is no ISO common name for this substance; the name “4-CPB” is approved by the Weed Science Society of America. |
| Structure: |  |
| Pronunciation: | for sē pē bē Guide to British pronunciation |
| InChIKey: | SIYAHZSHQIPQLY-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H11ClO3/c11-8-3-5-9(6-4-8)14-7-1-2-10(12)13/h3-6H,1-2,7H2,(H,12,13) |