| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | (naphthalen-1-yl)acetic acid and/or (naphthalen-2-yl)acetic acid |
| IUPAC name: | 1-naphthylacetic acid and/or 2-naphthylacetic acid |
| CAS name: | 1-naphthaleneacetic acid and/or 2-naphthaleneacetic acid |
| CAS Reg. No.: | 1-isomer: 86-87-3 2-isomer: 581-96-4 |
| Formula: | C12H10O2 |
| Activity: | plant growth regulators (auxin) |
| Notes: | These substances are considered by the International Organization for Standardization not to require a common name with “naphthylacetic acids” as an alternative. The systematic name “1-naphthylacetic acid” (萘乙酸) is approved as a common name in China. The name “NAA” has been used in the literature but it has no official approval. Derivatives include ammonium 1-naphthaleneacetate [25545-89-5], ethyl 1-naphthaleneacetate [2122-70-5], potassium 1-naphthaleneacetate [15165-79-4], sodium 1-naphthaleneacetate [61-31-4]. |
| Structure: |  |
| Pronunciation: | ǎl-fa nǎf-tha-lēn-a-sē-tǐk ǎs-ǐdz Guide to British pronunciation |
| InChIKey: | 1-isomer: PRPINYUDVPFIRX-UHFFFAOYSA-N 2-isomer: VIBOGIYPPWLDTI-UHFFFAOYSA-N |
| InChI: | 1-isomer: InChI=1S/C12H10O2/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H,13,14) 2-isomer: InChI=1S/C12H10O2/c13-12(14)8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7H,8H2,(H,13,14) |