ACC

French: ACC (n.m.)Russian: АЦК


Approval: ISO common name not required
IUPAC PIN: 1-aminocyclopropane-1-carboxylic acid
IUPAC name: 1-aminocyclopropanecarboxylic acid
CAS name: 1-aminocyclopropanecarboxylic acid
CAS Reg. No.: 22059-21-8
Formula: C4H7NO2
Activity: plant growth regulators (ethylene releaser)
Notes: This substance is considered by the International Organization for Standardization not to require a common name.
Structure: Structural formula of ACC
Pronunciation: ā sē sē   Guide to British pronunciation
InChIKey: PAJPWUMXBYXFCZ-UHFFFAOYSA-N
InChI: InChI=1S/C4H7NO2/c5-4(1-2-4)3(6)7/h1-2,5H2,(H,6,7)

A data sheet from the Compendium of Pesticide Common Names