| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | 1-aminocyclopropane-1-carboxylic acid |
| IUPAC name: | 1-aminocyclopropanecarboxylic acid |
| CAS name: | 1-aminocyclopropanecarboxylic acid |
| CAS Reg. No.: | 22059-21-8 |
| Formula: | C4H7NO2 |
| Activity: | plant growth regulators (ethylene releaser) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | ā sē sē Guide to British pronunciation |
| InChIKey: | PAJPWUMXBYXFCZ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C4H7NO2/c5-4(1-2-4)3(6)7/h1-2,5H2,(H,6,7) |
A data sheet from the Compendium of Pesticide Common Names