| Approval: |
ISO |
| IUPAC PIN: |
4-alkyl-2,5(or 2,6)-dimethylmorpholines, containing 65–75% 2,6-dimethylmorpholines and 35–25% 2,5-dimethylmorpholines, where more than 85% of the total is 4-dodecyl-2,5(or 2,6)-dimethylmorpholine, and where “alkyl” may also be octyl, decyl, tetradecyl or hexadecyl, and where the cis/trans ratio is 1:1; the major component is rac-(2R,6S)-4-dodecyl-2,6-dimethylmorpholine |
| IUPAC name: |
4-alkyl-2,5(or 2,6)-dimethylmorpholines, containing 65–75% 2,6-dimethylmorpholines and 35–25% 2,5-dimethylmorpholines, where more than 85% of the total is 4-dodecyl-2,5(or 2,6)-dimethylmorpholine, and where “alkyl” may also be octyl, decyl, tetradecyl or hexadecyl, and where the cis/trans ratio is 1:1; the major component is (2RS,6SR)-4-dodecyl-2,6-dimethylmorpholine |
| CAS name: |
aldimorph |
| CAS Reg. No.: |
91315-15-0 |
| Formula: |
C18H37NO (major component) |
| Activity: |
fungicides (morpholine) |
| Notes: |
|
| Structure: |
 |
| Pronunciation: |
ǎl-dǐ-morf Guide to British pronunciation |
| InChIKey: |
SBUKOHLFHYSZNG-UHFFFAOYSA-N (major component) |
| InChI: |
InChI=1S/C18H37NO/c1-4-5-6-7-8-9-10-11-12-13-14-19-15-17(2)20-18(3)16-19/h17-18H,4-16H2,1-3H3 (major component) |