| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | S-prop-2-en-1-yl prop-2-ene-1-sulfinothioate |
| IUPAC name: | S-allyl prop-2-ene-1-sulfinothioate |
| CAS name: | S-2-propen-1-yl 2-propene-1-sulfinothioate |
| CAS Reg. No.: | 539-86-6 |
| Formula: | C6H10OS2 |
| Activity: | fungicides (botanical) insecticides (botanical) molluscicides |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: |  |
| Pronunciation: | ǎl-ǐ-sǐn Guide to British pronunciation |
| InChIKey: | JDLKFOPOAOFWQN-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H10OS2/c1-3-5-8-9(7)6-4-2/h3-4H,1-2,5-6H2 |