Approval: | ISO |
---|---|
IUPAC PIN: | N2-ethyl-6-(methylsulfanyl)-N4-(propan-2-yl)-1,3,5-triazine-2,4-diamine |
IUPAC name: | N2-ethyl-N4-isopropyl-6-(methylthio)-1,3,5-triazine-2,4-diamine pre-1969 name: 2-(ethylamino)-4-(isopropylamino)-6-(methylthio)-1,3,5-triazine |
CAS name: | N2-ethyl-N4-(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine |
CAS Reg. No.: | 834-12-8 |
Formula: | C9H17N5S |
Activity: | herbicides (alkylthiotriazine) |
Notes: | The name “ametryne” was formerly approved by the British Standards Institution. |
Structure: | |
Pronunciation: | ǎm-ě-trǐn Guide to British pronunciation |
InChIKey: | RQVYBGPQFYCBGX-UHFFFAOYSA-N |
InChI: | InChI=1S/C9H17N5S/c1-5-10-7-12-8(11-6(2)3)14-9(13-7)15-4/h6H,5H2,1-4H3,(H2,10,11,12,13,14) |
A data sheet from the Compendium of Pesticide Common Names