| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | 3-[(2S)-piperidin-2-yl]pyridine |
| IUPAC name: | 3-[(2S)-2-piperidyl]pyridine |
| CAS name: | 3-(2S)-2-piperidinylpyridine |
| CAS Reg. No.: | 494-52-0 |
| Formula: | C10H14N2 |
| Activity: | insecticides (alkaloid) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The name “neonicotine” has been used in the literature, but it has no official approval. Derivatives include anabasine sulfate [6382-19-0]. |
| Structure: | |
| Pronunciation: | a-nǎb-a-sēn Guide to British pronunciation |
| InChIKey: | MTXSIJUGVMTTMU-JTQLQIEISA-N |
| InChI: | InChI=1S/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2/t10-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names