| Approval: | China |
|---|---|
| IUPAC PIN: | arsorotrithious tris(dimethylcarbamodithioic) tris(thioanhydride) |
| IUPAC name: | arsenotrithionous tris(dimethylcarbamodithioic) tris(thioanhydride) 1979 Rules: tris(dimethyldithiocarbamic) trithioarsenous tris(thioanhydride) |
| CAS name: | N,N-dimethylcarbamodithioic acid anhydrosulfide with arsenotrithious acid (3:1) |
| CAS Reg. No.: | 3586-60-5 |
| Formula: | C9H18AsN3S6 |
| Activity: | fungicides (arsenical; dimethyldithiocarbamate) |
| Notes: | There is no ISO common name for this substance; the name “asomate” (福美胂) is approved in China. |
| Structure: |  |
| Pronunciation: | ā-sō-māt Guide to British pronunciation |
| InChIKey: | GAMFEMAXLMWCRG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H18AsN3S6/c1-11(2)7(14)17-10(18-8(15)12(3)4)19-9(16)13(5)6/h1-6H3 |