Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 4-azido-6-(methylsulfanyl)-N-(propan-2-yl)-1,3,5-triazin-2-amine |
IUPAC name: | 4-azido-N-isopropyl-6-(methylthio)-1,3,5-triazin-2-amine 1979 Rules: 4-azido-N-isopropyl-6-(methylthio)-1,3,5-triazin-2-ylamine |
CAS name: | 4-azido-N-(1-methylethyl)-6-(methylthio)-1,3,5-triazin-2-amine |
CAS Reg. No.: | 4658-28-0 |
Formula: | C7H11N7S |
Activity: | herbicides (alkylthiotriazine) |
Notes: | The name “aziprotryn” is used in the USA. |
Structure: | |
Pronunciation: | ǎz-ǐ-prō-trin Guide to British pronunciation |
InChIKey: | AFIIBUOYKYSPKB-UHFFFAOYSA-N |
InChI: | InChI=1S/C7H11N7S/c1-4(2)9-5-10-6(13-14-8)12-7(11-5)15-3/h4H,1-3H3,(H,9,10,11,12) |
A data sheet from the Compendium of Pesticide Common Names