| Approval: | ISO common name not required | 
|---|---|
| IUPAC PIN: | diphenyldiazene | 
| IUPAC name: | azobenzene | 
| CAS name: | 1,2-diphenyldiazene | 
| CAS Reg. No.: | 103-33-3 | 
| Formula: | C12H10N2 | 
| Activity: | acaricides (unclassified) | 
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. | 
| Structure: | |
| Pronunciation: | āz-ō-běn-zēn Guide to British pronunciation | 
| InChIKey: | DMLAVOWQYNRWNQ-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C12H10N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10H | 
A data sheet from the Compendium of Pesticide Common Names