| Approval: | none |
|---|---|
| IUPAC PIN: | (6E)-7,11-dimethyl-3-methylenedodeca-1,6,10-triene |
| IUPAC name: | (E)-7,11-dimethyl-3-methylene-1,6,10-dodecatriene |
| CAS name: | (6E)-7,11-dimethyl-3-methylene-1,6,10-dodecatriene |
| CAS Reg. No.: | 18794-84-8 |
| Formula: | C15H24 |
| Activity: | insect attractants (kairomone attractant) |
| Notes: | There is no ISO common name for this substance; the names (E)-β-farnesene, trans-farnesene, β-farnesene and Eβf have been used in the literature but have no official approval. |
| Structure: | |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | JSNRRGGBADWTMC-NTCAYCPXSA-N |
| InChI: | InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9,12H,1,4,7-8,10-11H2,2-3,5H3/b15-12+ |
A data sheet from the Compendium of Pesticide Common Names