| Approval: | ISO preferred name |
|---|---|
| IUPAC name: | 2-(diethylamino)ethyl (2RS)-2-(4-chlorophenyl)-3-methylbutyrate hydrochloride |
| CAS name: | 2-(diethylamino)ethyl 4-chloro-α-(1-methylethyl)benzeneacetate hydrochloride |
| CAS Reg. No.: | 172351-12-1 |
| Formula: | C17H27Cl2NO2 |
| Activity: | plant growth regulators (unclassified) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | bǎk-měd-ěsh Guide to British pronunciation |
| InChIKey: | DJPMLIONMMBOSS-UHFFFAOYSA-N |
| InChI: | InChI=1S/C17H26ClNO2.ClH/c1-5-19(6-2)11-12-21-17(20)16(13(3)4)14-7-9-15(18)10-8-14;/h7-10,13,16H,5-6,11-12H2,1-4H3;1H |
A data sheet from the Compendium of Pesticide Common Names