| Approval: | ISO |
|---|---|
| IUPAC PIN: | 4-chlorobut-2-yn-1-yl (3-chlorophenyl)carbamate |
| IUPAC name: | 4-chlorobut-2-ynyl (3-chlorophenyl)carbamate 1979 Rules: 4-chlorobut-2-ynyl 3-chlorocarbanilate |
| CAS name: | 4-chloro-2-butyn-1-yl N-(3-chlorophenyl)carbamate |
| CAS Reg. No.: | 101-27-9 |
| Formula: | C11H9Cl2NO2 |
| Activity: | herbicides (carbamate) |
| Notes: | The name “barbanate” is used in South Africa, and the name “chlorinate” (хлоринат) was used in the former USSR. |
| Structure: |  |
| Pronunciation: | bar-bǎn Guide to British pronunciation |
| InChIKey: | MCOQHIWZJUDQIC-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H9Cl2NO2/c12-6-1-2-7-16-11(15)14-10-5-3-4-9(13)8-10/h3-5,8H,6-7H2,(H,14,15) |