| Approval: |
ISO common name not required |
| IUPAC name: |
copper(II) carbonate hydroxide (2:1:2) |
| CAS name: |
[μ-[carbonato(2−)-κO:κO′]]dihydroxydicopper |
| CAS Reg. No.: |
12069-69-1 |
| Formula: |
CH2Cu2O5 |
| Activity: |
fungicides (copper compound) |
| Notes: |
This substance is considered by the International Organization for Standardization not to require a common name; the name “copper carbonate, basic” has also been used. |
| Structure: |
 |
| Pronunciation: |
bā-sǐk kǒp-a car-ba-nāt Guide to British pronunciation |
| InChIKey: |
ZMMDPCMYTCRWFF-UHFFFAOYSA-J |
| InChI: |
InChI=1S/CH2O3.2Cu.2H2O/c2-1(3)4;;;;/h(H2,2,3,4);;;2*1H2/q;2*+2;;/p-4 |