Status: | ISO 765 (published) |
---|---|
IUPAC name: | copper(II) carbonate hydroxide (2:1:2) |
CAS name: | [μ-[carbonato(2−)-κO:κO′]]dihydroxydicopper |
CAS Reg. No.: | 12069-69-1 |
Formula: | CH2Cu2O5 |
Activity: | fungicides (copper compound) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. In ISO 765-1976, the name “copper carbonate, basic” was used. |
Structure: | |
Pronunciation: | bā-sǐk kǒp-a car-ba-nāt Guide to British pronunciation |
InChIKey: | ZMMDPCMYTCRWFF-UHFFFAOYSA-J |
InChI: | InChI=1S/CH2O3.2Cu.2H2O/c2-1(3)4;;;;/h(H2,2,3,4);;;2*1H2/q;2*+2;;/p-4 |
A data sheet from the Compendium of Pesticide Common Names