| Approval: | China |
|---|---|
| IUPAC PIN: | 2-phenyl-4H-3,1-benzoxazin-4-one |
| IUPAC name: | 2-phenyl-4H-3,1-benzoxazin-4-one |
| CAS name: | 2-phenyl-4H-3,1-benzoxazin-4-one |
| CAS Reg. No.: | 1022-46-4 |
| Formula: | C14H9NO2 |
| Activity: | herbicides (unclassified) |
| Notes: | There is no ISO common name for this substance; the name “bentranil” (苯草灭) is approved in China. |
| Structure: | |
| Pronunciation: | běn-trǎn-ǐl Guide to British pronunciation |
| InChIKey: | HTTLBYITFHMYFK-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H9NO2/c16-14-11-8-4-5-9-12(11)15-13(17-14)10-6-2-1-3-7-10/h1-9H |
A data sheet from the Compendium of Pesticide Common Names