Approval: | ISO |
---|---|
IUPAC PIN: | (2Ξ)-3-[benzyl(methyl)amino]-2-cyanoprop-2-enoic acid |
IUPAC name: | (2EZ)-3-[benzyl(methyl)amino]-2-cyanoprop-2-enoic acid 1979 Rules: (EZ)-3-[benzyl(methyl)amino]-2-cyanoacrylic acid |
CAS name: | 2-cyano-3-[methyl(phenylmethyl)amino]-2-propenoic acid |
CAS Reg. No.: | 127087-86-9 |
Formula: | C12H12N2O2 |
Activity: | fungicides (aminocyanoacrylate) |
Notes: | The proportion of (E)- and (Z)-isomers is temperature-dependent. Derivatives include benzamacril-isobutyl [88107-27-1]. |
Structure: | |
Pronunciation: | běnz-ǎm-a-krǐl Guide to British pronunciation |
InChIKey: | LCOWUMNPNWEMAZ-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H12N2O2/c1-14(9-11(7-13)12(15)16)8-10-5-3-2-4-6-10/h2-6,9H,8H2,1H3,(H,15,16) |
A data sheet from the Compendium of Pesticide Common Names