| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | N-hydroxybenzamide |
| IUPAC name: | benzohydroxamic acid |
| CAS name: | N-hydroxybenzamide |
| CAS Reg. No.: | 495-18-1 |
| Formula: | C7H7NO2 |
| Activity: | fungicides (benzamide) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | běn-zō-hī-drǒks-ǎm-ǐk ǎs-ǐd Guide to British pronunciation |
| InChIKey: | VDEUYMSGMPQMIK-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H7NO2/c9-7(8-10)6-4-2-1-3-5-6/h1-5,10H,(H,8,9) |
A data sheet from the Compendium of Pesticide Common Names