benzohydroxamic acid

French: acide benzohydroxamique (n.m.)Russian: бензогидроксамовая кислота


Approval: ISO common name not required
IUPAC PIN: N-hydroxybenzamide
IUPAC name: benzohydroxamic acid
CAS name: N-hydroxybenzamide
CAS Reg. No.: 495-18-1
Formula: C7H7NO2
Activity: fungicides (benzamide)
Notes: This substance is considered by the International Organization for Standardization not to require a common name.
Structure: Structural formula of benzohydroxamic acid
Pronunciation: běn-zō-hī-drǒks-ǎm-ǐk ǎs-ǐd  Guide to British pronunciation
InChIKey: VDEUYMSGMPQMIK-UHFFFAOYSA-N
InChI: InChI=1S/C7H7NO2/c9-7(8-10)6-4-2-1-3-5-6/h1-5,10H,(H,8,9)

A data sheet from the Compendium of Pesticide Common Names