Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | benzoic (Ξ)-3-chloro-N-ethoxy-2,6-dimethoxybenzene-1-carboximidic anhydride |
IUPAC name: | benzoic (EZ)-3-chloro-N-ethoxy-2,6-dimethoxybenzenecarboximidic anhydride |
CAS name: | benzoic acid anhydride with 3-chloro-N-ethoxy-2,6-dimethoxybenzenecarboximidic acid |
CAS Reg. No.: | 29104-30-1 |
Formula: | C18H18ClNO5 |
Activity: | acaricides (unclassified) |
Notes: | The name “benzomate” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
Structure: | |
Pronunciation: | běnz-ǒks-ǐ-māt Guide to British pronunciation |
InChIKey: | BZMIHNKNQJJVRO-UHFFFAOYSA-N |
InChI: | InChI=1S/C18H18ClNO5/c1-4-24-20-17(25-18(21)12-8-6-5-7-9-12)15-14(22-2)11-10-13(19)16(15)23-3/h5-11H,4H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names