| Approval: | China |
|---|---|
| IUPAC PIN: | methyl (2Ξ)-3-(fluoromethoxy)-2-(2-{[(3,5,6-trichloropyridin-2-yl)oxy]methyl}phenyl)prop-2-enoate |
| IUPAC name: | methyl (EZ)-3-(fluoromethoxy)-2-(2-{[(3,5,6-trichloro-2-pyridyl)oxy]methyl}phenyl)prop-2-enoate 1979 Rules: methyl (EZ)-3-(fluoromethoxy)-2-(2-{[(3,5,6-trichloro-2-pyridyl)oxy]methyl}phenyl)acrylate |
| CAS name: | methyl α-[(fluoromethoxy)methylene]-2-[[(3,5,6-trichloro-2-pyridinyl)oxy]methyl]benzeneacetate |
| CAS Reg. No.: | 927422-36-4 |
| Formula: | C17H13Cl3FNO4 |
| Activity: | acaricides (methoxyacrylate) fungicides (methoxyacrylate) |
| Notes: | There is no ISO common name for this substance; the name “bifujunzhi” (吡氟菌酯) is approved in China. |
| Structure: | |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | SPTIHHXLKJKKNM-UHFFFAOYSA-N |
| InChI: | InChI=1S/C17H13Cl3FNO4/c1-24-17(23)12(8-25-9-21)11-5-3-2-4-10(11)7-26-16-14(19)6-13(18)15(20)22-16/h2-6,8H,7,9H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names