| Approval: | ISO common name not required |
|---|---|
| IUPAC name: | disodium tetraborate decahydrate |
| CAS name: | borax |
| CAS Reg. No.: | 1303-96-4 |
| Formula: | B4H20Na2O17 |
| Activity: | herbicides (inorganic) insecticides (inorganic) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name with the name “disodium tetraborate” as an alternative. The name “borax” is approved by the Weed Science Society of America. |
| Structure: |  |
| Pronunciation: | bor-ǎks Guide to British pronunciation |
| InChIKey: | CDMADVZSLOHIFP-UHFFFAOYSA-N |
| InChI: | InChI=1S/B4O7.2Na.10H2O/c5-1-7-3-9-2(6)10-4(8-1)11-3;;;;;;;;;;;;/h;;;10*1H2/q-2;2*+1;;;;;;;;;; |