| Approval: | China |
|---|---|
| IUPAC PIN: | (Ξ)-[3-(4-bromophenoxy)phenyl](cyano)methyl (2Ξ)-2-(4-chlorophenyl)-3-methylbutanoate |
| IUPAC name: | (αRS)-3-(4-bromophenoxy)-α-cyanobenzyl (2RS)-2-(4-chlorophenyl)-3-methylbutyrate |
| CAS name: | [3-(4-bromophenoxy)phenyl]cyanomethyl 4-chloro-α-(1-methylethyl)benzeneacetate |
| CAS Reg. No.: | 65295-49-0 |
| Formula: | C25H21BrClNO3 |
| Activity: | insecticides (pyrethroid isovalerate ester) |
| Notes: | There is no ISO common name for this substance; the name “brofenvalerate” (溴灭菊酯) is approved in China. |
| Structure: | |
| Pronunciation: | brō-fěn-vǎl-er-āt Guide to British pronunciation |
| InChIKey: | MFJPBJVWUYEEPB-UHFFFAOYSA-N |
| InChI: | InChI=1S/C25H21BrClNO3/c1-16(2)24(17-6-10-20(27)11-7-17)25(29)31-23(15-28)18-4-3-5-22(14-18)30-21-12-8-19(26)9-13-21/h3-14,16,23-24H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names