Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 5-amino-4-bromo-2-phenylpyridazin-3(2H)-one |
IUPAC name: | 5-amino-4-bromo-2-phenylpyridazin-3(2H)-one |
CAS name: | 5-amino-4-bromo-2-phenyl-3(2H)-pyridazinone |
CAS Reg. No.: | 3042-84-0 |
Formula: | C10H8BrN3O |
Activity: | herbicides (pyridazinone) |
Notes: | The name “brompyrazone” was formerly approved by the British Standards Institution. |
Structure: | |
Pronunciation: | brǒm-pǐr-a-zǒn Guide to British pronunciation |
InChIKey: | ODNZLRLWXRXPOH-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H8BrN3O/c11-9-8(12)6-13-14(10(9)15)7-4-2-1-3-5-7/h1-6H,12H2 |
A data sheet from the Compendium of Pesticide Common Names