| Approval: | ISO common name not required |
|---|---|
| IUPAC name: | traditional mixture of copper sulfate and disodium carbonate in variable proportions |
| CAS name: | disodium carbonate mixture with copper(2+) sulfate (1:1) |
| CAS Reg. No.: | 11125-96-5 |
| Formula: | |
| Activity: | fungicides (copper compound) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: |  |
| Pronunciation: | ber-gan-dē mǐkst-sha Guide to British pronunciation |
| InChIKey: | copper(2+) sulfate (1:1): ARUVKPQLZAKDPS-UHFFFAOYSA-L disodium carbonate: CDBYLPFSWZWCQE-UHFFFAOYSA-L |
| InChI: | copper(2+) sulfate (1:1): InChI=1S/Cu.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2 disodium carbonate: InChI=1S/CH2O3.2Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 |