| Approval: | ISO |
|---|---|
| IUPAC PIN: | naphthalen-1-yl methylcarbamate |
| IUPAC name: | 1-naphthyl methylcarbamate |
| CAS name: | 1-naphthalenyl N-methylcarbamate |
| CAS Reg. No.: | 63-25-2 |
| Formula: | C12H11NO2 |
| Activity: | acaricides (carbamate) insecticides (carbamate) plant growth regulators (growth inhibitor) |
| Notes: | The name “carbaril” is approved by the World Health Organization; the Chinese version is “卡巴立” and the Russian version is “карбарил”. The name “sevin” (цевин) was used in the former USSR, but Sevin is a registered trade mark in many countries. |
| Structure: |  |
| Pronunciation: | kar-ba-rīl Guide to British pronunciation |
| InChIKey: | CVXBEEMKQHEXEN-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H11NO2/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3,(H,13,14) |