| Approval: | ISO |
|---|---|
| IUPAC PIN: | methyl 1H-1,3-benzimidazol-2-ylcarbamate |
| IUPAC name: | methyl 1H-benzimidazol-2-ylcarbamate |
| CAS name: | methyl N-1H-benzimidazol-2-ylcarbamate |
| CAS Reg. No.: | 10605-21-7 |
| Formula: | C9H9N3O2 |
| Activity: | fungicides (benzimidazole) |
| Notes: | The name “carbendazol” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. Derivatives include carbendazim benzenesulfonate, carbendazim sulfite. |
| Structure: |  |
| Pronunciation: | kar-běn-da-zǐm Guide to British pronunciation |
| InChIKey: | TWFZGCMQGLPBSX-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H9N3O2/c1-14-9(13)12-8-10-6-4-2-3-5-7(6)11-8/h2-5H,1H3,(H2,10,11,12,13) |