| Approval: | USSR |
|---|---|
| IUPAC PIN: | di(azepan-1-yl)methanone |
| IUPAC name: | di(azepan-1-yl) ketone 1979 Rules: bis(perhydroazepin-1-yl) ketone |
| CAS name: | bis(hexahydro-1H-azepin-1-yl)methanone |
| CAS Reg. No.: | 25991-86-0 |
| Formula: | C13H24N2O |
| Activity: | insect repellents |
| Notes: | There is no ISO common name for this substance; the name “carboxide” (карбоксид) was used in the former USSR. In some countries, “Carboxide” is a trade name for a fumigant containing a mixture of ethylene oxide and carbon dioxide. |
| Structure: |  |
| Pronunciation: | kar-bǒk-sīd Guide to British pronunciation |
| InChIKey: | BZDSNHCMPJUKOY-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H24N2O/c16-13(14-9-5-1-2-6-10-14)15-11-7-3-4-8-12-15/h1-12H2 |