| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | 2-methyl-5-(propan-2-yl)phenol |
| IUPAC name: | 5-isopropyl-2-methylphenol |
| CAS name: | 2-methyl-5-(1-methylethyl)phenol |
| CAS Reg. No.: | 499-75-2 |
| Formula: | C10H14O |
| Activity: | acaricides (botanical) fungicides (botanical) insecticides (botanical) nematicides (botanical) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: |  |
| Pronunciation: | kar-va-krǒl Guide to British pronunciation |
| InChIKey: | RECUKUPTGUEGMW-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |