| Approval: | WSSA |
|---|---|
| IUPAC PIN: | 2-chloroethyl (3-chlorophenyl)carbamate |
| IUPAC name: | 2-chloroethyl (3-chlorophenyl)carbamate 1979 Rules: 2-chloroethyl 3-chlorocarbanilate |
| CAS name: | 2-chloroethyl N-(3-chlorophenyl)carbamate |
| CAS Reg. No.: | 587-56-4 |
| Formula: | C9H9Cl2NO2 |
| Activity: | herbicides (carbamate) |
| Notes: | There is no ISO common name for this substance; the name “CEPC” is approved by the Weed Science Society of America. |
| Structure: |  |
| Pronunciation: | sē ē pē sē Guide to British pronunciation |
| InChIKey: | GYJQWEIGUGMFMU-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H9Cl2NO2/c10-4-5-14-9(13)12-8-3-1-2-7(11)6-8/h1-3,6H,4-5H2,(H,12,13) |