Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 2,4-dichloro-1-(3-methoxy-4-nitrophenoxy)benzene |
IUPAC name: | 2,4-dichloro-1-(3-methoxy-4-nitrophenoxy)benzene 1979 Rules: 5-(2,4-dichlorophenoxy)-2-nitroanisole |
CAS name: | 2,4-dichloro-1-(3-methoxy-4-nitrophenoxy)benzene |
CAS Reg. No.: | 32861-85-1 |
Formula: | C13H9Cl2NO4 |
Activity: | herbicides (diphenyl ether) |
Notes: | The name “chlormethoxynil” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
Structure: | |
Pronunciation: | klō-měth-ǒk-sē-fěn Guide to British pronunciation |
InChIKey: | DXXVCXKMSWHGTF-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H9Cl2NO4/c1-19-13-7-9(3-4-11(13)16(17)18)20-12-5-2-8(14)6-10(12)15/h2-7H,1H3 |
A data sheet from the Compendium of Pesticide Common Names