Approval: | WHO INN |
---|---|
IUPAC PIN: | 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
IUPAC name: | 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]acetamide |
CAS name: | 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]acetamide |
CAS Reg. No.: | 56-75-7 |
Formula: | C11H12Cl2N2O5 |
Activity: | bactericides |
Notes: | There is no ISO common name for this substance; the name “chloramphenicol” is approved by the World Health Organization. |
Structure: | |
Pronunciation: | klor-ǎm-fěn-ǐ-kǒl Guide to British pronunciation |
InChIKey: | WIIZWVCIJKGZOK-RKDXNWHRSA-N |
InChI: | InChI=1S/C11H12Cl2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18)/t8-,9-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names