Approval: | ISO common name not required |
---|---|
IUPAC PIN: | 2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione |
IUPAC name: | tetrachloro-p-benzoquinone |
CAS name: | 2,3,5,6-tetrachloro-2,5-cyclohexadiene-1,4-dione |
CAS Reg. No.: | 118-75-2 |
Formula: | C6Cl4O2 |
Activity: | fungicides (quinone) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | klor-a-nǐl Guide to British pronunciation |
InChIKey: | UGNWTBMOAKPKBL-UHFFFAOYSA-N |
InChI: | InChI=1S/C6Cl4O2/c7-1-2(8)6(12)4(10)3(9)5(1)11 |
A data sheet from the Compendium of Pesticide Common Names