Approval: | ISO |
---|---|
IUPAC PIN: | N-(3,4-dichlorophenyl)-2-methylprop-2-enamide |
IUPAC name: | 3′,4′-dichloro-2-methylprop-2-enanilide 1979 Rules: 3′,4′-dichloro-2-methylacrylanilide |
CAS name: | N-(3,4-dichlorophenyl)-2-methyl-2-propenamide |
CAS Reg. No.: | 2164-09-2 |
Formula: | C10H9Cl2NO |
Activity: | herbicides (anilide) |
Notes: | The name “dicryl” is used in Canada and the USA. |
Structure: | |
Pronunciation: | klor-ǎn-ō-krǐl Guide to British pronunciation |
InChIKey: | VCBRBUKGTWLJOB-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H9Cl2NO/c1-6(2)10(14)13-7-3-4-8(11)9(12)5-7/h3-5H,1H2,2H3,(H,13,14) |
A data sheet from the Compendium of Pesticide Common Names