| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | chloroacetic acid |
| IUPAC name: | chloroacetic acid |
| CAS name: | 2-chloroacetic acid |
| CAS Reg. No.: | 79-11-8 |
| Formula: | C2H3ClO2 |
| Activity: | herbicides (halogenated alkanoic acid) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name with the name “monochloroacetic acid” as an alternative. The name “MCA” (short for monochloroacetic acid) has been used in the literature, but it has no official approval. The Chinese name “一氯乙酸” has also been used in the literature. Derivatives include sodium chloroacetate [3926-62-3]. |
| Structure: |  |
| Pronunciation: | klor-ō-a-sē-tǐk ǎs-ǐd Guide to British pronunciation |
| InChIKey: | FOCAUTSVDIKZOP-UHFFFAOYSA-N |
| InChI: | InChI=1S/C2H3ClO2/c3-1-2(4)5/h1H2,(H,4,5) |