Approval: | ISO |
---|---|
IUPAC PIN: | 2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile |
IUPAC name: | tetrachloroisophthalonitrile |
CAS name: | 2,4,5,6-tetrachloro-1,3-benzenedicarbonitrile |
CAS Reg. No.: | 1897-45-6 |
Formula: | C8Cl4N2 |
Activity: | fungicides (chloronitrile) |
Notes: | The name “TPN” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
Structure: | |
Pronunciation: | klor-ō-thǎl-ō-nǐl Guide to British pronunciation |
InChIKey: | CRQQGFGUEAVUIL-UHFFFAOYSA-N |
InChI: | InChI=1S/C8Cl4N2/c9-5-3(1-13)6(10)8(12)7(11)4(5)2-14 |
A data sheet from the Compendium of Pesticide Common Names