| Approval: | JMAFF |
|---|---|
| IUPAC PIN: | 2-(4-chlorophenyl)-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione |
| IUPAC name: | N-(4-chlorophenyl)cyclohex-1-ene-1,2-dicarboximide or N-(4-chlorophenyl)-3,4,5,6-tetrahydrophthalimide |
| CAS name: | 2-(4-chlorophenyl)-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione |
| CAS Reg. No.: | 39985-63-2 |
| Formula: | C14H12ClNO2 |
| Activity: | herbicides (N-phenylimide) |
| Notes: | There is no ISO common name for this substance; the name “chlorphthalim” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. The name chlorophthalim has been used in the literature, but it has no official approval. |
| Structure: | |
| Pronunciation: | klor-fthǎl-ǐm Guide to British pronunciation |
| InChIKey: | MJQBFSWPMMHVSM-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H12ClNO2/c15-9-5-7-10(8-6-9)16-13(17)11-3-1-2-4-12(11)14(16)18/h5-8H,1-4H2 |
A data sheet from the Compendium of Pesticide Common Names