Approval: | ISO |
---|---|
IUPAC PIN: | propan-2-yl (3-chlorophenyl)carbamate |
IUPAC name: | isopropyl (3-chlorophenyl)carbamate 1979 Rules: isopropyl 3-chlorocarbanilate |
CAS name: | 1-methylethyl N-(3-chlorophenyl)carbamate |
CAS Reg. No.: | 101-21-3 |
Formula: | C10H12ClNO2 |
Activity: | herbicides (phenyl carbamate) plant growth regulators (growth inhibitor) |
Notes: | The name “chlor-IPC” (хлор-ИФК) was used in the former USSR. |
Structure: | |
Pronunciation: | klor-prō-fǎm Guide to British pronunciation |
InChIKey: | CWJSHJJYOPWUGX-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H12ClNO2/c1-7(2)14-10(13)12-9-5-3-4-8(11)6-9/h3-7H,1-2H3,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names