Approval: | WHO INN |
---|---|
IUPAC PIN: | (2Ξ)-1-butyl-N-(3,4-dichlorophenyl)pyrrolidin-2-imine |
IUPAC name: | N-[(2EZ)-1-butylpyrrolidin-2-ylidene]-3,4-dichloroaniline |
CAS name: | N-(1-butyl-2-pyrrolidinylidene)-3,4-dichlorobenzenamine |
CAS Reg. No.: | 27050-41-5 |
Formula: | C14H18Cl2N2 |
Activity: | acaricides (formamidine) |
Notes: | There is no ISO common name for this substance; the name “clenpirin” is approved by the World Health Organization (the Chinese version is “克仑吡林” and the Russian version is “кленпирин”). The name “clenpyrin” is approved by the British Pharmacopoeia Commission. |
Structure: | |
Pronunciation: | klěn-pǐr-ǐn Guide to British pronunciation |
InChIKey: | MKSYSNRVVYYBIZ-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H18Cl2N2/c1-2-3-8-18-9-4-5-14(18)17-11-6-7-12(15)13(16)10-11/h6-7,10H,2-5,8-9H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names