| Approval: | ISO |
|---|---|
| IUPAC PIN: | rac-3-[(1R)-1-(furan-2-yl)-3-oxobutyl]-4-hydroxy-2H-1-benzopyran-2-one |
| IUPAC name: | 3-[(1RS)-1-(2-furyl)-3-oxobutyl]-4-hydroxy-2H-chromen-2-one 1979 Rules: 3-[(RS)-1-(2-furyl)-3-oxobutyl]-4-hydroxycoumarin |
| CAS name: | 3-[1-(2-furanyl)-3-oxobutyl]-4-hydroxy-2H-1-benzopyran-2-one |
| CAS Reg. No.: | 117-52-2 |
| Formula: | C17H14O5 |
| Activity: | rodenticides (coumarin) |
| Notes: | The name “fumarin” was formerly used in Canada and formerly approved by the British Standards Institution, and the name “tomarin” was formerly used in Turkey. |
| Structure: |  |
| Pronunciation: | koom-a-fǔr-īl Guide to British pronunciation |
| InChIKey: | JFIXKFSJCQNGEK-UHFFFAOYSA-N |
| InChI: | InChI=1S/C17H14O5/c1-10(18)9-12(13-7-4-8-21-13)15-16(19)11-5-2-3-6-14(11)22-17(15)20/h2-8,12,19H,9H2,1H3 |