| Approval: | ESA |
|---|---|
| IUPAC PIN: | 4-(3-oxobutyl)phenyl acetate |
| IUPAC name: | p-(3-oxobutyl)phenyl acetate |
| CAS name: | 4-[4-(acetyloxy)phenyl]-2-butanone |
| CAS Reg. No.: | 3572-06-3 |
| Formula: | C12H14O3 |
| Activity: | insect attractants (Dipteran) |
| Notes: | There is no ISO common name for this substance; the name “cue-lure” is approved by the Entomological Society of America. This substance is named after the insect that it is used to attract, Bactrocera cucurbitae (Coquillett) (Tephritidae, Diptera). |
| Structure: |  |
| Pronunciation: | kū-lūr Guide to British pronunciation |
| InChIKey: | UMIKWXDGXDJQJK-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H14O3/c1-9(13)3-4-11-5-7-12(8-6-11)15-10(2)14/h5-8H,3-4H2,1-2H3 |