Status: | ISO 1750 (approved) |
---|---|
IUPAC name: | tricopper dichloride dimethyldithiocarbamate |
CAS name: | dichloro(dimethylcarbamodithioato)tricopper |
CAS Reg. No.: | 7076-63-3 |
Formula: | C3H6Cl2Cu3NS2 |
Activity: | fungicides (copper compound; dimethyldithiocarbamate) |
Notes: | The name “cuprobam” was formerly approved by the British Standards Institution and was adopted by ISO in 2020. |
Structure: | |
Pronunciation: | kū-prō-bǎm Guide to British pronunciation |
InChIKey: | VQSUKBFBVMSNES-UHFFFAOYSA-K |
InChI: | InChI=1S/C3H7NS2.2ClH.3Cu/c1-4(2)3(5)6;;;;;/h1-2H3,(H,5,6);2*1H;;;/q;;;3*+1/p-3 |
A data sheet from the Compendium of Pesticide Common Names