Approval: | ISO |
---|---|
IUPAC PIN: | mixture of 80–100% N-[(1S,2S)-2-(2,4-dibromophenyl)cyclobutyl]-2-nitrobenzamide and 20–0% of the (1R,2R)-enantiomer |
IUPAC name: | mixture of 80–100% N-[(1S,2S)-2-(2,4-dibromophenyl)cyclobutyl]-2-nitrobenzamide and 20–0% of the (1R,2R)-enantiomer |
CAS name: | N-[2-(2,4-dibromophenyl)cyclobutyl]-2-nitrobenzamide |
CAS Reg. No.: | 3052252-62-4 |
Formula: | C17H14Br2N2O3 |
Activity: | fungicides (unclassified) |
Notes: | The Registry Number of the major component is 3038582-85-0. |
Structure: | |
Pronunciation: | Guide to British pronunciation |
InChIKey: | WNSVVHDJHHRFDF-WFASDCNBSA-N (1S,2S isomer) |
InChI: | InChI=1S/C17H14Br2N2O3/c18-10-5-6-11(14(19)9-10)12-7-8-15(12)20-17(22)13-3-1-2-4-16(13)21(23)24/h1-6,9,12,15H,7-8H2,(H,20,22)/t12-,15-/m0/s1 (1S,2S isomer) |
A data sheet from the Compendium of Pesticide Common Names