| Approval: | China | 
|---|---|
| IUPAC PIN: | 4-chloro-5-[(6-chloropyridin-3-yl)methoxy]-2-(3,4-dichlorophenyl)pyridazin-3(2H)-one | 
| IUPAC name: | 4-chloro-5-[(6-chloro-3-pyridyl)methoxy]-2-(3,4-dichlorophenyl)pyridazin-3(2H)-one | 
| CAS name: | 4-chloro-5-[(6-chloro-3-pyridinyl)methoxy]-2-(3,4-dichlorophenyl)-3(2H)-pyridazinone | 
| CAS Reg. No.: | 107360-34-9 | 
| Formula: | C16H9Cl4N3O2 | 
| Activity: | insecticides (juvenile hormone mimic) | 
| Notes: | There is no ISO common name for this substance; the name “dayoutong” (哒幼酮) is approved in China. | 
| Structure: | |
| Pronunciation: | dar yoo tǒng Guide to British pronunciation | 
| InChIKey: | BAJLRQTYSBSGKY-UHFFFAOYSA-N | 
| InChI: | InChI=1S/C16H9Cl4N3O2/c17-11-3-2-10(5-12(11)18)23-16(24)15(20)13(7-22-23)25-8-9-1-4-14(19)21-6-9/h1-7H,8H2 | 
A data sheet from the Compendium of Pesticide Common Names